N,N-Dimethyl-b-alanine HCl
3-Dimethylaminopropionic acid hydrochloride
CAS: 14788-12-6
Molecular Formula: C5H12ClNO2
N,N-Dimethyl-b-alanine HCl - Names and Identifiers
| Name | 3-Dimethylaminopropionic acid hydrochloride |
| Synonyms | N,N-dimethyl-beta-alanine N,N-Dimethyl-b-alanine HCl N,N-Dimethyl-β-alanine HCl 3-DimethylaminopropionicacidHCl N,N-DIMETHYL-BETA-ALANINE HYDROCHLORIDE Dimethylaminopropionicacidhydrochloride 3-Dimethylaminopropionic acid hydrochloride 3-DIMETHYLAMINOPROPIONIC ACID HYDROCHLORIDE β-(Dimethylamino)propanoic acid hydrochloride 3-(DiMethylaMino)propanoic acid hydrochloride |
| CAS | 14788-12-6 |
| InChI | InChI=1/C5H11NO2.ClH/c1-6(2)4-3-5(7)8;/h3-4H2,1-2H3,(H,7,8);1H |
| InChIKey | JTNKXYWGZCNBCH-UHFFFAOYSA-N |
N,N-Dimethyl-b-alanine HCl - Physico-chemical Properties
| Molecular Formula | C5H12ClNO2 |
| Molar Mass | 153.61 |
| Melting Point | 186.0 to 192.0 °C |
| Boling Point | 192.6°C at 760 mmHg |
| Flash Point | 70.3°C |
| Water Solubility | almost transparency |
| Solubility | DMSO (Slightly), Methanol (Slightly) |
| Vapor Presure | 0.212mmHg at 25°C |
| Appearance | Solid |
| Color | White to Off-White |
| Storage Condition | Inert atmosphere,Room Temperature |
| Stability | Hygroscopic |
| MDL | MFCD02093464 |
N,N-Dimethyl-b-alanine HCl - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36 - Irritating to the eyes |
| Safety Description | 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 3 |
N,N-Dimethyl-b-alanine HCl - Introduction
3-Dimethylaminopropionic acid, also known as pentapiridine hydrochloride (HCl DMHP), is an organic compound.
Nature:
1. Appearance: HCl DMHP is a white crystalline powder or crystal.
2. Solubility: It is easy to dissolve in water and can form a hydrochloride solution.
3. pKa value: HCl DMHP is moderately acidic, and the pKa value is about 7-8.
4. Stability: It is relatively stable, but it may decompose when encountering strong oxidants and high temperatures.
Use:
1. Drug: HCl DMHP can be used to synthesize certain drugs, such as phenacetin, etc., usually as an intermediate.
2. Anesthetics: Pentapiridine hydrochloride can also be used as an anesthetic for surgical or analgesic purposes.
Method:
The preparation method of HCl DMHP is often carried out by chemical reaction. The specific steps can include reacting dimethylaminoacetone and hydrochloric acid to generate 3-Dimethylaminopropionic acid hydrochloride, which is then crystallized, process steps such as drying give the final product.
Safety Information:
1. HCl DMHP is an organic acid salt. Attention should be paid to avoid contact with skin, eyes, etc., so as not to cause irritation and damage.
2. When using or handling HCl DMHP, you should wear appropriate personal protective equipment, such as chemical protective gloves and goggles, to ensure safe operation.
3. HCl DMHP should be used in a well-ventilated environment to avoid inhalation of harmful gases.
4. Try to avoid contact with strong oxidants and high temperatures to prevent decomposition or dangerous substances.
Please note that information on the nature, use and safety of chemical substances should only be properly understood and used under the guidance of a professional.
Nature:
1. Appearance: HCl DMHP is a white crystalline powder or crystal.
2. Solubility: It is easy to dissolve in water and can form a hydrochloride solution.
3. pKa value: HCl DMHP is moderately acidic, and the pKa value is about 7-8.
4. Stability: It is relatively stable, but it may decompose when encountering strong oxidants and high temperatures.
Use:
1. Drug: HCl DMHP can be used to synthesize certain drugs, such as phenacetin, etc., usually as an intermediate.
2. Anesthetics: Pentapiridine hydrochloride can also be used as an anesthetic for surgical or analgesic purposes.
Method:
The preparation method of HCl DMHP is often carried out by chemical reaction. The specific steps can include reacting dimethylaminoacetone and hydrochloric acid to generate 3-Dimethylaminopropionic acid hydrochloride, which is then crystallized, process steps such as drying give the final product.
Safety Information:
1. HCl DMHP is an organic acid salt. Attention should be paid to avoid contact with skin, eyes, etc., so as not to cause irritation and damage.
2. When using or handling HCl DMHP, you should wear appropriate personal protective equipment, such as chemical protective gloves and goggles, to ensure safe operation.
3. HCl DMHP should be used in a well-ventilated environment to avoid inhalation of harmful gases.
4. Try to avoid contact with strong oxidants and high temperatures to prevent decomposition or dangerous substances.
Please note that information on the nature, use and safety of chemical substances should only be properly understood and used under the guidance of a professional.
Last Update：2024-04-09 15:17:52
Supplier List
Spot supply
Product Name: N,N-Dimethyl-Beta-Alanine Hydrochloride Visit Supplier Webpage Request for quotationCAS: 14788-12-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Spot supply
Product Name: N,N-Dimethyl-Beta-Alanine Hydrochloride Visit Supplier Webpage Request for quotationCAS: 14788-12-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History